C19H19N3 — CID 43824580
N-[(1-phenylpyrazol-4-yl)methyl]-2,3-dihydro-1H-inden-5-amine (PubChem CID 43824580) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[(1-phenylpyrazol-4-yl)methyl]-2,3-dihydro-1H-inden-5-amine.
| Compound Name | N-[(1-phenylpyrazol-4-yl)methyl]-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 43824580 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[(1-phenylpyrazol-4-yl)methyl]-2,3-dihydro-1H-inden-5-amine |
| SMILES | c1ccc(-n2cc(CNc3ccc4c(c3)CCC4)cn2)cc1 |
| InChI | InChI=1S/C19H19N3/c1-2-7-19(8-3-1)22-14-15(13-21-22)12-20-18-10-9-16-5-4-6-17(16)11-18/h1-3,7-11,13-14,20H,4-6,12H2 |
| InChIKey | HUMCOCVJWHWRDU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |