C11H15FN2O — CID 115925836
3-(4-fluoro-2-methylanilino)butanamide (PubChem CID 115925836) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-(4-fluoro-2-methylanilino)butanamide.
| Compound Name | 3-(4-fluoro-2-methylanilino)butanamide |
|---|---|
| PubChem CID | 115925836 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-(4-fluoro-2-methylanilino)butanamide |
| SMILES | Cc1cc(F)ccc1NC(C)CC(N)=O |
| InChI | InChI=1S/C11H15FN2O/c1-7-5-9(12)3-4-10(7)14-8(2)6-11(13)15/h3-5,8,14H,6H2,1-2H3,(H2,13,15) |
| InChIKey | MRKURRHTHDTEMZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |