C10H14FN3O — CID 63731312
2-(1-aminopropan-2-ylamino)-5-fluorobenzamide (PubChem CID 63731312) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-(1-aminopropan-2-ylamino)-5-fluorobenzamide.
| Compound Name | 2-(1-aminopropan-2-ylamino)-5-fluorobenzamide |
|---|---|
| PubChem CID | 63731312 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(1-aminopropan-2-ylamino)-5-fluorobenzamide |
| SMILES | CC(CN)Nc1ccc(F)cc1C(N)=O |
| InChI | InChI=1S/C10H14FN3O/c1-6(5-12)14-9-3-2-7(11)4-8(9)10(13)15/h2-4,6,14H,5,12H2,1H3,(H2,13,15) |
| InChIKey | HGSKFPLNHSFELT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |