About 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol
2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol (PubChem CID 115927169) has the molecular formula C16H27NO2S
and a molecular weight of 297.46 g/mol. Its IUPAC name is 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol |
| PubChem CID | 115927169 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol |
| SMILES | CC(C)(C)c1csc(CC(CO)(CO)C2CCCC2)n1 |
| InChI | InChI=1S/C16H27NO2S/c1-15(2,3)13-9-20-14(17-13)8-16(10-18,11-19)12-6-4-5-7-12/h9,12,18-19H,4-8,10-11H2,1-3H3 |
| InChIKey | ZFCSUWZDDBQOLH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol?
The IUPAC name of 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol (CID 115927169) is 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol.
What is the SMILES notation for 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol?
The canonical SMILES for 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol is CC(C)(C)c1csc(CC(CO)(CO)C2CCCC2)n1.
What is the InChIKey of 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol?
The InChIKey is ZFCSUWZDDBQOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2S/c1-15(2,3)13-9-20-14(17-13)8-16(10-18,11-19)12-6-4-5-7-12/h9,12,18-19H,4-8,10-11H2,1-3H3.
What are the key properties of 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol?
2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol has a molecular weight of 297.46 g/mol, XLogP of 3.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-cyclopentylpropane-1,3-diol is sourced from PubChem (CID 115927169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).