C14H22N2OS — CID 116547629
2-(4-tert-butyl-1,3-thiazol-2-yl)-1-piperidin-4-ylethanone (PubChem CID 116547629) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-piperidin-4-ylethanone.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 116547629 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-piperidin-4-ylethanone |
| SMILES | CC(C)(C)c1csc(CC(=O)C2CCNCC2)n1 |
| InChI | InChI=1S/C14H22N2OS/c1-14(2,3)12-9-18-13(16-12)8-11(17)10-4-6-15-7-5-10/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | XMLPQMGMSBQHTC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |