C13H22N2OS — CID 114451769
3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperidin-4-ol (PubChem CID 114451769) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperidin-4-ol.
| Compound Name | 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 114451769 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperidin-4-ol |
| SMILES | CC(C)(C)c1csc(CC2CNCCC2O)n1 |
| InChI | InChI=1S/C13H22N2OS/c1-13(2,3)11-8-17-12(15-11)6-9-7-14-5-4-10(9)16/h8-10,14,16H,4-7H2,1-3H3 |
| InChIKey | KSISWRXOYLGQHF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |