C13H20N2O — CID 146286067
3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-4-ol (PubChem CID 146286067) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-4-ol.
| Compound Name | 3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 146286067 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-4-ol |
| SMILES | Cc1cc(CC2CNCCC2O)cc(C)n1 |
| InChI | InChI=1S/C13H20N2O/c1-9-5-11(6-10(2)15-9)7-12-8-14-4-3-13(12)16/h5-6,12-14,16H,3-4,7-8H2,1-2H3 |
| InChIKey | RIAIVSGCXBMEOV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |