C16H21Br3O — CID 115927228
1-bromo-3-[4-bromo-3-(bromomethyl)-3-cyclopentylbutoxy]benzene (PubChem CID 115927228) has the molecular formula C16H21Br3O and a molecular weight of 469.06 g/mol. Its IUPAC name is 1-bromo-3-[4-bromo-3-(bromomethyl)-3-cyclopentylbutoxy]benzene.
| Compound Name | 1-bromo-3-[4-bromo-3-(bromomethyl)-3-cyclopentylbutoxy]benzene |
|---|---|
| PubChem CID | 115927228 |
| Molecular Formula | C16H21Br3O |
| Molecular Weight | 469.06 g/mol |
| Exact Mass | 465.91 |
| IUPAC Name | 1-bromo-3-[4-bromo-3-(bromomethyl)-3-cyclopentylbutoxy]benzene |
| SMILES | BrCC(CBr)(CCOc1cccc(Br)c1)C1CCCC1 |
| InChI | InChI=1S/C16H21Br3O/c17-11-16(12-18,13-4-1-2-5-13)8-9-20-15-7-3-6-14(19)10-15/h3,6-7,10,13H,1-2,4-5,8-9,11-12H2 |
| InChIKey | XVJXAAUGERXSEA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.06 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|