About [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol
[1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol (PubChem CID 115928015) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol |
| PubChem CID | 115928015 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol |
| SMILES | CC(CCn1cncn1)NC1(CO)CCC1 |
| InChI | InChI=1S/C11H20N4O/c1-10(3-6-15-9-12-8-13-15)14-11(7-16)4-2-5-11/h8-10,14,16H,2-7H2,1H3 |
| InChIKey | IVCWTDIDSJUKKY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol?
The IUPAC name of [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol (CID 115928015) is [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol.
What is the SMILES notation for [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol?
The canonical SMILES for [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol is CC(CCn1cncn1)NC1(CO)CCC1.
What is the InChIKey of [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol?
The InChIKey is IVCWTDIDSJUKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-10(3-6-15-9-12-8-13-15)14-11(7-16)4-2-5-11/h8-10,14,16H,2-7H2,1H3.
What are the key properties of [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol?
[1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol has a molecular weight of 224.31 g/mol, XLogP of 0.56, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(1,2,4-triazol-1-yl)butan-2-ylamino]cyclobutyl]methanol is sourced from PubChem (CID 115928015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).