C10H20N4O — CID 115705135
N-(3-methoxypropyl)-4-(1,2,4-triazol-1-yl)butan-2-amine (PubChem CID 115705135) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-(1,2,4-triazol-1-yl)butan-2-amine.
| Compound Name | N-(3-methoxypropyl)-4-(1,2,4-triazol-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 115705135 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N-(3-methoxypropyl)-4-(1,2,4-triazol-1-yl)butan-2-amine |
| SMILES | COCCCNC(C)CCn1cncn1 |
| InChI | InChI=1S/C10H20N4O/c1-10(12-5-3-7-15-2)4-6-14-9-11-8-13-14/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | QKYGQBGPHSMNCW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|