About molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine
molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine (PubChem CID 156801663) has the molecular formula C11H22N4O
and a molecular weight of 226.32 g/mol. Its IUPAC name is molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine.
Molecular Properties
| Compound Name | molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine |
| PubChem CID | 156801663 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine |
| SMILES | CCC(C)NCC1(Cn2cncn2)COC1.[H][H] |
| InChI | InChI=1S/C11H20N4O.H2/c1-3-10(2)13-4-11(6-16-7-11)5-15-9-12-8-14-15;/h8-10,13H,3-7H2,1-2H3;1H |
| InChIKey | GZFZYHVWZRELBS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine?
The IUPAC name of molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine (CID 156801663) is molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine.
What is the SMILES notation for molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine?
The canonical SMILES for molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine is CCC(C)NCC1(Cn2cncn2)COC1.[H][H].
What is the InChIKey of molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine?
The InChIKey is GZFZYHVWZRELBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O.H2/c1-3-10(2)13-4-11(6-16-7-11)5-15-9-12-8-14-15;/h8-10,13H,3-7H2,1-2H3;1H.
What are the key properties of molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine?
molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine has a molecular weight of 226.32 g/mol, XLogP of 0.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]butan-2-amine is sourced from PubChem (CID 156801663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).