C12H16F3N — CID 115928156
2,5-dimethyl-N-(4,4,4-trifluorobutan-2-yl)aniline (PubChem CID 115928156) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is 2,5-dimethyl-N-(4,4,4-trifluorobutan-2-yl)aniline.
| Compound Name | 2,5-dimethyl-N-(4,4,4-trifluorobutan-2-yl)aniline |
|---|---|
| PubChem CID | 115928156 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2,5-dimethyl-N-(4,4,4-trifluorobutan-2-yl)aniline |
| SMILES | Cc1ccc(C)c(NC(C)CC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N/c1-8-4-5-9(2)11(6-8)16-10(3)7-12(13,14)15/h4-6,10,16H,7H2,1-3H3 |
| InChIKey | TXYZZUJUPJTIDG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |