C15H22N2O2 — CID 115929140
3-[2-(1-cyclopropylpropan-2-ylamino)phenoxy]propanamide (PubChem CID 115929140) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-[2-(1-cyclopropylpropan-2-ylamino)phenoxy]propanamide.
| Compound Name | 3-[2-(1-cyclopropylpropan-2-ylamino)phenoxy]propanamide |
|---|---|
| PubChem CID | 115929140 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-[2-(1-cyclopropylpropan-2-ylamino)phenoxy]propanamide |
| SMILES | CC(CC1CC1)Nc1ccccc1OCCC(N)=O |
| InChI | InChI=1S/C15H22N2O2/c1-11(10-12-6-7-12)17-13-4-2-3-5-14(13)19-9-8-15(16)18/h2-5,11-12,17H,6-10H2,1H3,(H2,16,18) |
| InChIKey | BQUIWAIMVGVIBW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |