C17H26N2O2 — CID 43729752
3-[2-[(2,6-dimethylcyclohexyl)amino]phenoxy]propanamide (PubChem CID 43729752) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-[2-[(2,6-dimethylcyclohexyl)amino]phenoxy]propanamide.
| Compound Name | 3-[2-[(2,6-dimethylcyclohexyl)amino]phenoxy]propanamide |
|---|---|
| PubChem CID | 43729752 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-[2-[(2,6-dimethylcyclohexyl)amino]phenoxy]propanamide |
| SMILES | CC1CCCC(C)C1Nc1ccccc1OCCC(N)=O |
| InChI | InChI=1S/C17H26N2O2/c1-12-6-5-7-13(2)17(12)19-14-8-3-4-9-15(14)21-11-10-16(18)20/h3-4,8-9,12-13,17,19H,5-7,10-11H2,1-2H3,(H2,18,20) |
| InChIKey | XLMWKFYVHFAXID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |