About 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine
2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine (PubChem CID 115929193) has the molecular formula C14H21ClN2O
and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine |
| PubChem CID | 115929193 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine |
| SMILES | CC(Nc1ccc(N(C)C)c(Cl)c1)C1CCOC1 |
| InChI | InChI=1S/C14H21ClN2O/c1-10(11-6-7-18-9-11)16-12-4-5-14(17(2)3)13(15)8-12/h4-5,8,10-11,16H,6-7,9H2,1-3H3 |
| InChIKey | SRAYFAGCQSALAB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine?
The IUPAC name of 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine (CID 115929193) is 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine.
What is the SMILES notation for 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine?
The canonical SMILES for 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine is CC(Nc1ccc(N(C)C)c(Cl)c1)C1CCOC1.
What is the InChIKey of 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine?
The InChIKey is SRAYFAGCQSALAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClN2O/c1-10(11-6-7-18-9-11)16-12-4-5-14(17(2)3)13(15)8-12/h4-5,8,10-11,16H,6-7,9H2,1-3H3.
What are the key properties of 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine?
2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine has a molecular weight of 268.79 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-N,1-N-dimethyl-4-N-[1-(oxolan-3-yl)ethyl]benzene-1,4-diamine is sourced from PubChem (CID 115929193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).