C15H17ClN2OS — CID 115930368
3-amino-2-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide (PubChem CID 115930368) has the molecular formula C15H17ClN2OS and a molecular weight of 308.83 g/mol. Its IUPAC name is 3-amino-2-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide.
| Compound Name | 3-amino-2-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 115930368 |
| Molecular Formula | C15H17ClN2OS |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-amino-2-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)N(C)C(=O)c2cccc(N)c2Cl)s1 |
| InChI | InChI=1S/C15H17ClN2OS/c1-9-7-8-13(20-9)10(2)18(3)15(19)11-5-4-6-12(17)14(11)16/h4-8,10H,17H2,1-3H3 |
| InChIKey | HJVJKHMJTXLCHB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|