C11H11ClN2O5S — CID 115930933
(2-chloro-3-nitrophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 115930933) has the molecular formula C11H11ClN2O5S and a molecular weight of 318.74 g/mol. Its IUPAC name is (2-chloro-3-nitrophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (2-chloro-3-nitrophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 115930933 |
| Molecular Formula | C11H11ClN2O5S |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (2-chloro-3-nitrophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1Cl)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H11ClN2O5S/c12-10-8(2-1-3-9(10)14(16)17)11(15)13-4-6-20(18,19)7-5-13/h1-3H,4-7H2 |
| InChIKey | VQMHJNHZGVNMOH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|