C16H16N2O3 — CID 115932824
3-(furan-2-ylmethyl)-2-propan-2-ylbenzimidazole-4-carboxylic acid (PubChem CID 115932824) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-propan-2-ylbenzimidazole-4-carboxylic acid.
| Compound Name | 3-(furan-2-ylmethyl)-2-propan-2-ylbenzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115932824 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-propan-2-ylbenzimidazole-4-carboxylic acid |
| SMILES | CC(C)c1nc2cccc(C(=O)O)c2n1Cc1ccco1 |
| InChI | InChI=1S/C16H16N2O3/c1-10(2)15-17-13-7-3-6-12(16(19)20)14(13)18(15)9-11-5-4-8-21-11/h3-8,10H,9H2,1-2H3,(H,19,20) |
| InChIKey | JUEFUWTTXLWREY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |