C15H25N3O2 — CID 115933991
methyl 3-amino-2-[3-(diethylamino)propylamino]benzoate (PubChem CID 115933991) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 3-amino-2-[3-(diethylamino)propylamino]benzoate.
| Compound Name | methyl 3-amino-2-[3-(diethylamino)propylamino]benzoate |
|---|---|
| PubChem CID | 115933991 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | methyl 3-amino-2-[3-(diethylamino)propylamino]benzoate |
| SMILES | CCN(CC)CCCNc1c(N)cccc1C(=O)OC |
| InChI | InChI=1S/C15H25N3O2/c1-4-18(5-2)11-7-10-17-14-12(15(19)20-3)8-6-9-13(14)16/h6,8-9,17H,4-5,7,10-11,16H2,1-3H3 |
| InChIKey | HGIRGXAEIGFZJI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|