C14H19ClN2O3 — CID 115936129
[1-(butylamino)-1-oxopropan-2-yl] 3-amino-2-chlorobenzoate (PubChem CID 115936129) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is [1-(butylamino)-1-oxopropan-2-yl] 3-amino-2-chlorobenzoate.
| Compound Name | [1-(butylamino)-1-oxopropan-2-yl] 3-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 115936129 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [1-(butylamino)-1-oxopropan-2-yl] 3-amino-2-chlorobenzoate |
| SMILES | CCCCNC(=O)C(C)OC(=O)c1cccc(N)c1Cl |
| InChI | InChI=1S/C14H19ClN2O3/c1-3-4-8-17-13(18)9(2)20-14(19)10-6-5-7-11(16)12(10)15/h5-7,9H,3-4,8,16H2,1-2H3,(H,17,18) |
| InChIKey | FSRHNTIGUOBEOT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|