C11H11NO3 — CID 11593666
(1R,2R,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carbonitrile (PubChem CID 11593666) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (1R,2R,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carbonitrile.
| Compound Name | (1R,2R,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carbonitrile |
|---|---|
| PubChem CID | 11593666 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (1R,2R,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carbonitrile |
| SMILES | CO[C@]12C=C[C@H](C[C@@H]1C#N)[C@@]1(CO1)C2=O |
| InChI | InChI=1S/C11H11NO3/c1-14-10-3-2-7(4-8(10)5-12)11(6-15-11)9(10)13/h2-3,7-8H,4,6H2,1H3/t7-,8-,10-,11+/m1/s1 |
| InChIKey | GISRYRJXMQVETQ-OYBPUVFXSA-N |
| XLogP | 0.44 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|