C15H14F4N2 — CID 115940849
1-(5-fluoro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 115940849) has the molecular formula C15H14F4N2 and a molecular weight of 298.28 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 115940849 |
| Molecular Formula | C15H14F4N2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CCC(N)(c1cccc(C(F)(F)F)c1)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H14F4N2/c1-2-14(20,13-7-6-12(16)9-21-13)10-4-3-5-11(8-10)15(17,18)19/h3-9H,2,20H2,1H3 |
| InChIKey | CYQPQIUXVFLPQB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |