C11H20N4S2 — CID 11594244
1-prop-2-enyl-3-[3-(prop-2-enylcarbamothioylamino)propyl]thiourea (PubChem CID 11594244) has the molecular formula C11H20N4S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[3-(prop-2-enylcarbamothioylamino)propyl]thiourea.
| Compound Name | 1-prop-2-enyl-3-[3-(prop-2-enylcarbamothioylamino)propyl]thiourea |
|---|---|
| PubChem CID | 11594244 |
| Molecular Formula | C11H20N4S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-prop-2-enyl-3-[3-(prop-2-enylcarbamothioylamino)propyl]thiourea |
| SMILES | C=CCNC(=S)NCCCNC(=S)NCC=C |
| InChI | InChI=1S/C11H20N4S2/c1-3-6-12-10(16)14-8-5-9-15-11(17)13-7-4-2/h3-4H,1-2,5-9H2,(H2,12,14,16)(H2,13,15,17) |
| InChIKey | QHPUXXYLWSNVPJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|