C15H21N3O2 — CID 115943140
N-methyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]quinazolin-2-amine (PubChem CID 115943140) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-methyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]quinazolin-2-amine.
| Compound Name | N-methyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]quinazolin-2-amine |
|---|---|
| PubChem CID | 115943140 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-methyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]quinazolin-2-amine |
| SMILES | CNc1nc(OCCOC(C)(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,3)20-10-9-19-13-11-7-5-6-8-12(11)17-14(16-4)18-13/h5-8H,9-10H2,1-4H3,(H,16,17,18) |
| InChIKey | TUOVHJQOJVLAJT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|