C12H15N3O3S — CID 69085012
N-(4-propoxyquinazolin-2-yl)methanesulfonamide (PubChem CID 69085012) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(4-propoxyquinazolin-2-yl)methanesulfonamide.
| Compound Name | N-(4-propoxyquinazolin-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 69085012 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(4-propoxyquinazolin-2-yl)methanesulfonamide |
| SMILES | CCCOc1nc(NS(C)(=O)=O)nc2ccccc12 |
| InChI | InChI=1S/C12H15N3O3S/c1-3-8-18-11-9-6-4-5-7-10(9)13-12(14-11)15-19(2,16)17/h4-7H,3,8H2,1-2H3,(H,13,14,15) |
| InChIKey | MFDKEZDKHNOFFS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |