C14H10N4O3 — CID 115944669
3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid (PubChem CID 115944669) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid.
| Compound Name | 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 115944669 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid |
| SMILES | N#Cc1ncn(CCOc2cccc(C(=O)O)c2)c1C#N |
| InChI | InChI=1S/C14H10N4O3/c15-7-12-13(8-16)18(9-17-12)4-5-21-11-3-1-2-10(6-11)14(19)20/h1-3,6,9H,4-5H2,(H,19,20) |
| InChIKey | NFEWXTCJBUQWKV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |