3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid

C14H10N4O3 — CID 115944669

IUPAC3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid
SMILESN#Cc1ncn(CCOc2cccc(C(=O)O)c2)c1C#N
InChIInChI=1S/C14H10N4O3/c15-7-12-13(8-16)18(9-17-12)4-5-21-11-3-1-2-10(6-11)14(19)20/h1-3,6,9H,4-5H2,(H,19,20)
InChIKeyNFEWXTCJBUQWKV-UHFFFAOYSA-N
MW282.26 g/mol
LogP1.40
Rot. Bonds5

About 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid

3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid (PubChem CID 115944669) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid.

Molecular Properties

Compound Name3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid
PubChem CID115944669
Molecular FormulaC14H10N4O3
Molecular Weight282.26 g/mol
Exact Mass282.08
IUPAC Name3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid
SMILESN#Cc1ncn(CCOc2cccc(C(=O)O)c2)c1C#N
InChIInChI=1S/C14H10N4O3/c15-7-12-13(8-16)18(9-17-12)4-5-21-11-3-1-2-10(6-11)14(19)20/h1-3,6,9H,4-5H2,(H,19,20)
InChIKeyNFEWXTCJBUQWKV-UHFFFAOYSA-N
XLogP1.40
TPSA111.93 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.26
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid?
The IUPAC name of 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid (CID 115944669) is 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid.
What is the SMILES notation for 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid?
The canonical SMILES for 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid is N#Cc1ncn(CCOc2cccc(C(=O)O)c2)c1C#N.
What is the InChIKey of 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid?
The InChIKey is NFEWXTCJBUQWKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O3/c15-7-12-13(8-16)18(9-17-12)4-5-21-11-3-1-2-10(6-11)14(19)20/h1-3,6,9H,4-5H2,(H,19,20).
What are the key properties of 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid?
3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid has a molecular weight of 282.26 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4,5-dicyanoimidazol-1-yl)ethoxy]benzoic acid is sourced from PubChem (CID 115944669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).