C14H14N6O — CID 115944840
1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]imidazole-4,5-dicarbonitrile (PubChem CID 115944840) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is 1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 115944840 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]imidazole-4,5-dicarbonitrile |
| SMILES | COCCNCc1ccc(-n2cnc(C#N)c2C#N)nc1 |
| InChI | InChI=1S/C14H14N6O/c1-21-5-4-17-8-11-2-3-14(18-9-11)20-10-19-12(6-15)13(20)7-16/h2-3,9-10,17H,4-5,8H2,1H3 |
| InChIKey | DDKFKJCYJTTWHC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|