C15H21N5 — CID 115945513
N,4-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-triazol-3-amine (PubChem CID 115945513) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is N,4-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-triazol-3-amine.
| Compound Name | N,4-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115945513 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N,4-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(C2Cc3ccccc3CN2)n1CC |
| InChI | InChI=1S/C15H21N5/c1-3-16-15-19-18-14(20(15)4-2)13-9-11-7-5-6-8-12(11)10-17-13/h5-8,13,17H,3-4,9-10H2,1-2H3,(H,16,19) |
| InChIKey | PJOOMLDXMBRYNV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |