C13H10BrFN2O3 — CID 115946867
8-(5-bromo-2-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione (PubChem CID 115946867) has the molecular formula C13H10BrFN2O3 and a molecular weight of 341.14 g/mol. Its IUPAC name is 8-(5-bromo-2-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione.
| Compound Name | 8-(5-bromo-2-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
|---|---|
| PubChem CID | 115946867 |
| Molecular Formula | C13H10BrFN2O3 |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 8-(5-bromo-2-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
| SMILES | O=C1NC(=O)C2(CCC2)C(=O)N1c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H10BrFN2O3/c14-7-2-3-8(15)9(6-7)17-11(19)13(4-1-5-13)10(18)16-12(17)20/h2-3,6H,1,4-5H2,(H,16,18,20) |
| InChIKey | IQYXIPQJLROHNM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|