C14H11N3O3S — CID 115947290
6-hydroxy-5-phenyl-1-(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-dione (PubChem CID 115947290) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 6-hydroxy-5-phenyl-1-(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-phenyl-1-(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115947290 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 6-hydroxy-5-phenyl-1-(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2nccs2)c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C14H11N3O3S/c18-12-11(9-4-2-1-3-5-9)13(19)17(14(20)16-12)8-10-15-6-7-21-10/h1-7,19H,8H2,(H,16,18,20) |
| InChIKey | YPNOELUXLWRWPP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |