C16H20N2O3 — CID 115948124
6-hydroxy-1-(4-methylpentyl)-5-phenylpyrimidine-2,4-dione (PubChem CID 115948124) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methylpentyl)-5-phenylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(4-methylpentyl)-5-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115948124 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 6-hydroxy-1-(4-methylpentyl)-5-phenylpyrimidine-2,4-dione |
| SMILES | CC(C)CCCn1c(O)c(-c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20N2O3/c1-11(2)7-6-10-18-15(20)13(14(19)17-16(18)21)12-8-4-3-5-9-12/h3-5,8-9,11,20H,6-7,10H2,1-2H3,(H,17,19,21) |
| InChIKey | RBUNXIHNIAERBB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |