C15H18N2O3S — CID 115948298
6-hydroxy-5-(3-methylphenyl)-1-(3-methylsulfanylpropyl)pyrimidine-2,4-dione (PubChem CID 115948298) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 6-hydroxy-5-(3-methylphenyl)-1-(3-methylsulfanylpropyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-(3-methylphenyl)-1-(3-methylsulfanylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115948298 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 6-hydroxy-5-(3-methylphenyl)-1-(3-methylsulfanylpropyl)pyrimidine-2,4-dione |
| SMILES | CSCCCn1c(O)c(-c2cccc(C)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H18N2O3S/c1-10-5-3-6-11(9-10)12-13(18)16-15(20)17(14(12)19)7-4-8-21-2/h3,5-6,9,19H,4,7-8H2,1-2H3,(H,16,18,20) |
| InChIKey | GHUKWCRPWYGYQP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|