C13H12FN3O4 — CID 115946839
3-[5-(3-fluorophenyl)-6-hydroxy-2,4-dioxopyrimidin-1-yl]propanamide (PubChem CID 115946839) has the molecular formula C13H12FN3O4 and a molecular weight of 293.25 g/mol. Its IUPAC name is 3-[5-(3-fluorophenyl)-6-hydroxy-2,4-dioxopyrimidin-1-yl]propanamide.
| Compound Name | 3-[5-(3-fluorophenyl)-6-hydroxy-2,4-dioxopyrimidin-1-yl]propanamide |
|---|---|
| PubChem CID | 115946839 |
| Molecular Formula | C13H12FN3O4 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-[5-(3-fluorophenyl)-6-hydroxy-2,4-dioxopyrimidin-1-yl]propanamide |
| SMILES | NC(=O)CCn1c(O)c(-c2cccc(F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H12FN3O4/c14-8-3-1-2-7(6-8)10-11(19)16-13(21)17(12(10)20)5-4-9(15)18/h1-3,6,20H,4-5H2,(H2,15,18)(H,16,19,21) |
| InChIKey | CTLKNHGSFVNLLY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |