C13H13FN2O3 — CID 112598483
5-(2-fluorophenyl)-6-hydroxy-1-propylpyrimidine-2,4-dione (PubChem CID 112598483) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-6-hydroxy-1-propylpyrimidine-2,4-dione.
| Compound Name | 5-(2-fluorophenyl)-6-hydroxy-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112598483 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-(2-fluorophenyl)-6-hydroxy-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(O)c(-c2ccccc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H13FN2O3/c1-2-7-16-12(18)10(11(17)15-13(16)19)8-5-3-4-6-9(8)14/h3-6,18H,2,7H2,1H3,(H,15,17,19) |
| InChIKey | KWDNXLJUUGUUGW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |