C15H13FN2O3 — CID 106222291
5-(2-fluorophenyl)-6-hydroxy-1-pent-4-ynylpyrimidine-2,4-dione (PubChem CID 106222291) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-6-hydroxy-1-pent-4-ynylpyrimidine-2,4-dione.
| Compound Name | 5-(2-fluorophenyl)-6-hydroxy-1-pent-4-ynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106222291 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 5-(2-fluorophenyl)-6-hydroxy-1-pent-4-ynylpyrimidine-2,4-dione |
| SMILES | C#CCCCn1c(O)c(-c2ccccc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H13FN2O3/c1-2-3-6-9-18-14(20)12(13(19)17-15(18)21)10-7-4-5-8-11(10)16/h1,4-5,7-8,20H,3,6,9H2,(H,17,19,21) |
| InChIKey | KKZOMFLCOSPKMJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|