C13H15N3O3S — CID 115947511
5,5-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 115947511) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 5,5-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115947511 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5,5-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)C(=O)NC(=O)N(c2nc3c(s2)CCCC3)C1=O |
| InChI | InChI=1S/C13H15N3O3S/c1-13(2)9(17)15-11(19)16(10(13)18)12-14-7-5-3-4-6-8(7)20-12/h3-6H2,1-2H3,(H,15,17,19) |
| InChIKey | BJJZQQKCESCOMK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|