C10H9Cl2N3S — CID 175863191
2-(3,6-dichloro-1H-pyridazin-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (PubChem CID 175863191) has the molecular formula C10H9Cl2N3S and a molecular weight of 274.18 g/mol. Its IUPAC name is 2-(3,6-dichloro-1H-pyridazin-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
| Compound Name | 2-(3,6-dichloro-1H-pyridazin-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
|---|---|
| PubChem CID | 175863191 |
| Molecular Formula | C10H9Cl2N3S |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 2-(3,6-dichloro-1H-pyridazin-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
| SMILES | ClC1=CC=C(Cl)N(c2nc3c(s2)CCC3)N1 |
| InChI | InChI=1S/C10H9Cl2N3S/c11-8-4-5-9(12)15(14-8)10-13-6-2-1-3-7(6)16-10/h4-5,14H,1-3H2 |
| InChIKey | YNHNMBNRDNPEKW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|