C15H22N2O4 — CID 115947861
4-(2-methoxycyclopentyl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 115947861) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-(2-methoxycyclopentyl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | 4-(2-methoxycyclopentyl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 115947861 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-(2-methoxycyclopentyl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | COC1CCCC1N1C(=O)NC(=O)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C15H22N2O4/c1-21-11-7-5-6-10(11)17-13(19)15(8-3-2-4-9-15)12(18)16-14(17)20/h10-11H,2-9H2,1H3,(H,16,18,20) |
| InChIKey | TYLSCEYPJPIGIO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|