C18H21NO2S — CID 11594827
(2S)-2-[(S)-(2-methoxyphenyl)sulfanyl-phenylmethyl]morpholine (PubChem CID 11594827) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is (2S)-2-[(S)-(2-methoxyphenyl)sulfanyl-phenylmethyl]morpholine.
| Compound Name | (2S)-2-[(S)-(2-methoxyphenyl)sulfanyl-phenylmethyl]morpholine |
|---|---|
| PubChem CID | 11594827 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2S)-2-[(S)-(2-methoxyphenyl)sulfanyl-phenylmethyl]morpholine |
| SMILES | COc1ccccc1S[C@@H](c1ccccc1)[C@@H]1CNCCO1 |
| InChI | InChI=1S/C18H21NO2S/c1-20-15-9-5-6-10-17(15)22-18(14-7-3-2-4-8-14)16-13-19-11-12-21-16/h2-10,16,18-19H,11-13H2,1H3/t16-,18-/m0/s1 |
| InChIKey | VWKLNUPRXXIKKE-WMZOPIPTSA-N |
| XLogP | 3.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |