C19H23NOS — CID 69432021
(2R)-2-[(2-ethylphenyl)sulfanyl-phenylmethyl]morpholine (PubChem CID 69432021) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is (2R)-2-[(2-ethylphenyl)sulfanyl-phenylmethyl]morpholine.
| Compound Name | (2R)-2-[(2-ethylphenyl)sulfanyl-phenylmethyl]morpholine |
|---|---|
| PubChem CID | 69432021 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2R)-2-[(2-ethylphenyl)sulfanyl-phenylmethyl]morpholine |
| SMILES | CCc1ccccc1SC(c1ccccc1)[C@H]1CNCCO1 |
| InChI | InChI=1S/C19H23NOS/c1-2-15-8-6-7-11-18(15)22-19(16-9-4-3-5-10-16)17-14-20-12-13-21-17/h3-11,17,19-20H,2,12-14H2,1H3/t17-,19?/m1/s1 |
| InChIKey | FQPOMYWVOPCCHO-DUSLRRAJSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |