C14H23N3O3 — CID 115948943
1-(1,2-dimethylpiperidin-4-yl)-5-propyl-1,3-diazinane-2,4,6-trione (PubChem CID 115948943) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(1,2-dimethylpiperidin-4-yl)-5-propyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1,2-dimethylpiperidin-4-yl)-5-propyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115948943 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-(1,2-dimethylpiperidin-4-yl)-5-propyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC1C(=O)NC(=O)N(C2CCN(C)C(C)C2)C1=O |
| InChI | InChI=1S/C14H23N3O3/c1-4-5-11-12(18)15-14(20)17(13(11)19)10-6-7-16(3)9(2)8-10/h9-11H,4-8H2,1-3H3,(H,15,18,20) |
| InChIKey | JYWISMZLZQGDPP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|