C12H19N3O4 — CID 106236626
5-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)pentanamide (PubChem CID 106236626) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)pentanamide.
| Compound Name | 5-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)pentanamide |
|---|---|
| PubChem CID | 106236626 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 5-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)pentanamide |
| SMILES | CCCC1C(=O)NC(=O)N(CCCCC(N)=O)C1=O |
| InChI | InChI=1S/C12H19N3O4/c1-2-5-8-10(17)14-12(19)15(11(8)18)7-4-3-6-9(13)16/h8H,2-7H2,1H3,(H2,13,16)(H,14,17,19) |
| InChIKey | DCJFUINLYQTKAW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|