C10H16N4O4 — CID 112601615
2-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)ethylurea (PubChem CID 112601615) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)ethylurea.
| Compound Name | 2-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)ethylurea |
|---|---|
| PubChem CID | 112601615 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(2,4,6-trioxo-5-propyl-1,3-diazinan-1-yl)ethylurea |
| SMILES | CCCC1C(=O)NC(=O)N(CCNC(N)=O)C1=O |
| InChI | InChI=1S/C10H16N4O4/c1-2-3-6-7(15)13-10(18)14(8(6)16)5-4-12-9(11)17/h6H,2-5H2,1H3,(H3,11,12,17)(H,13,15,18) |
| InChIKey | NYVPECMJPOVEQT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|