C21H32N2O — CID 11595089
(3R,8aR)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 11595089) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (3R,8aR)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (3R,8aR)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 11595089 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (3R,8aR)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | c1cc([C@H]2CC[C@H]3CCCCN32)ccc1OCCN1CCCCC1 |
| InChI | InChI=1S/C21H32N2O/c1-3-13-22(14-4-1)16-17-24-20-10-7-18(8-11-20)21-12-9-19-6-2-5-15-23(19)21/h7-8,10-11,19,21H,1-6,9,12-17H2/t19-,21-/m1/s1 |
| InChIKey | HOQPEMLLDRJXOV-TZIWHRDSSA-N |
| XLogP | 4.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |