C15H13ClN2OS — CID 115951090
2-[[(5-chloro-1,3-benzothiazol-4-yl)amino]methyl]-6-methylphenol (PubChem CID 115951090) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-[[(5-chloro-1,3-benzothiazol-4-yl)amino]methyl]-6-methylphenol.
| Compound Name | 2-[[(5-chloro-1,3-benzothiazol-4-yl)amino]methyl]-6-methylphenol |
|---|---|
| PubChem CID | 115951090 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[[(5-chloro-1,3-benzothiazol-4-yl)amino]methyl]-6-methylphenol |
| SMILES | Cc1cccc(CNc2c(Cl)ccc3scnc23)c1O |
| InChI | InChI=1S/C15H13ClN2OS/c1-9-3-2-4-10(15(9)19)7-17-13-11(16)5-6-12-14(13)18-8-20-12/h2-6,8,17,19H,7H2,1H3 |
| InChIKey | YSLWBYLWOHQGJN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|