C17H26FNO — CID 115958688
1-[2-(3-ethylcyclohexyl)oxy-3-fluorophenyl]propan-2-amine (PubChem CID 115958688) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is 1-[2-(3-ethylcyclohexyl)oxy-3-fluorophenyl]propan-2-amine.
| Compound Name | 1-[2-(3-ethylcyclohexyl)oxy-3-fluorophenyl]propan-2-amine |
|---|---|
| PubChem CID | 115958688 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-[2-(3-ethylcyclohexyl)oxy-3-fluorophenyl]propan-2-amine |
| SMILES | CCC1CCCC(Oc2c(F)cccc2CC(C)N)C1 |
| InChI | InChI=1S/C17H26FNO/c1-3-13-6-4-8-15(11-13)20-17-14(10-12(2)19)7-5-9-16(17)18/h5,7,9,12-13,15H,3-4,6,8,10-11,19H2,1-2H3 |
| InChIKey | ZVEWQQLURNFEJE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |