C18H28FNO — CID 115958807
1-[2-(3,4-dimethylcyclohexyl)oxy-3-fluorophenyl]butan-2-amine (PubChem CID 115958807) has the molecular formula C18H28FNO and a molecular weight of 293.43 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylcyclohexyl)oxy-3-fluorophenyl]butan-2-amine.
| Compound Name | 1-[2-(3,4-dimethylcyclohexyl)oxy-3-fluorophenyl]butan-2-amine |
|---|---|
| PubChem CID | 115958807 |
| Molecular Formula | C18H28FNO |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 1-[2-(3,4-dimethylcyclohexyl)oxy-3-fluorophenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cccc(F)c1OC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C18H28FNO/c1-4-15(20)11-14-6-5-7-17(19)18(14)21-16-9-8-12(2)13(3)10-16/h5-7,12-13,15-16H,4,8-11,20H2,1-3H3 |
| InChIKey | FDNVNZLAMUGSRJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |