C19H26N2O6 — CID 11595994
(4R)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-6,6-dimethyl-4-propan-2-yl-1,3-oxazinan-2-one (PubChem CID 11595994) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is (4R)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-6,6-dimethyl-4-propan-2-yl-1,3-oxazinan-2-one.
| Compound Name | (4R)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-6,6-dimethyl-4-propan-2-yl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 11595994 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (4R)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-6,6-dimethyl-4-propan-2-yl-1,3-oxazinan-2-one |
| SMILES | CC(C)[C@H]1CC(C)(C)OC(=O)N1C(=O)[C@H](C)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H26N2O6/c1-11(2)15-10-19(4,5)27-18(24)20(15)17(23)12(3)16(22)13-6-8-14(9-7-13)21(25)26/h6-9,11-12,15-16,22H,10H2,1-5H3/t12-,15-,16-/m1/s1 |
| InChIKey | MDSQHKCXYFTWMV-DAXOMENPSA-N |
| XLogP | 3.44 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|