C15H23BrN2O2 — CID 115963795
[1-[2-(3-bromophenoxy)ethyl]-4-methoxypiperidin-2-yl]methanamine (PubChem CID 115963795) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.26 g/mol. Its IUPAC name is [1-[2-(3-bromophenoxy)ethyl]-4-methoxypiperidin-2-yl]methanamine.
| Compound Name | [1-[2-(3-bromophenoxy)ethyl]-4-methoxypiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 115963795 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [1-[2-(3-bromophenoxy)ethyl]-4-methoxypiperidin-2-yl]methanamine |
| SMILES | COC1CCN(CCOc2cccc(Br)c2)C(CN)C1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-19-14-5-6-18(13(10-14)11-17)7-8-20-15-4-2-3-12(16)9-15/h2-4,9,13-14H,5-8,10-11,17H2,1H3 |
| InChIKey | OWJYTOWDFUZSSC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |