About [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate
[1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate (PubChem CID 102562742) has the molecular formula C18H26BrNO4
and a molecular weight of 400.31 g/mol. Its IUPAC name is [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate.
Molecular Properties
| Compound Name | [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate |
| PubChem CID | 102562742 |
| Molecular Formula | C18H26BrNO4 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate |
| SMILES | COC(C)CC(=O)OC1CCN(CCOc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H26BrNO4/c1-14(22-2)12-18(21)24-16-6-8-20(9-7-16)10-11-23-17-5-3-4-15(19)13-17/h3-5,13-14,16H,6-12H2,1-2H3 |
| InChIKey | VEHMTRIOULAXFN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate?
The IUPAC name of [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate (CID 102562742) is [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate.
What is the SMILES notation for [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate?
The canonical SMILES for [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate is COC(C)CC(=O)OC1CCN(CCOc2cccc(Br)c2)CC1.
What is the InChIKey of [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate?
The InChIKey is VEHMTRIOULAXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26BrNO4/c1-14(22-2)12-18(21)24-16-6-8-20(9-7-16)10-11-23-17-5-3-4-15(19)13-17/h3-5,13-14,16H,6-12H2,1-2H3.
What are the key properties of [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate?
[1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate has a molecular weight of 400.31 g/mol, XLogP of 3.26, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(3-bromophenoxy)ethyl]piperidin-4-yl] 3-methoxybutanoate is sourced from PubChem (CID 102562742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).